C23H28O8 — CID 155053480
1-O-[[4-(1-hydroperoxyethyl)phenyl]methyl] 4-O-[[4-(2-hydroperoxypropan-2-yl)phenyl]methyl] butanedioate (PubChem CID 155053480) has the molecular formula C23H28O8 and a molecular weight of 432.47 g/mol. Its IUPAC name is 1-O-[[4-(1-hydroperoxyethyl)phenyl]methyl] 4-O-[[4-(2-hydroperoxypropan-2-yl)phenyl]methyl] butanedioate.
| Compound Name | 1-O-[[4-(1-hydroperoxyethyl)phenyl]methyl] 4-O-[[4-(2-hydroperoxypropan-2-yl)phenyl]methyl] butanedioate |
|---|---|
| PubChem CID | 155053480 |
| Molecular Formula | C23H28O8 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1-O-[[4-(1-hydroperoxyethyl)phenyl]methyl] 4-O-[[4-(2-hydroperoxypropan-2-yl)phenyl]methyl] butanedioate |
| SMILES | CC(OO)c1ccc(COC(=O)CCC(=O)OCc2ccc(C(C)(C)OO)cc2)cc1 |
| InChI | InChI=1S/C23H28O8/c1-16(30-26)19-8-4-17(5-9-19)14-28-21(24)12-13-22(25)29-15-18-6-10-20(11-7-18)23(2,3)31-27/h4-11,16,26-27H,12-15H2,1-3H3 |
| InChIKey | INLKSNHWQDPCHA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|