C17H26ClNO2 — CID 65126990
(4-chlorophenyl)methyl 4-(2-aminoethyl)-5,5-dimethylhexanoate (PubChem CID 65126990) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 4-(2-aminoethyl)-5,5-dimethylhexanoate.
| Compound Name | (4-chlorophenyl)methyl 4-(2-aminoethyl)-5,5-dimethylhexanoate |
|---|---|
| PubChem CID | 65126990 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (4-chlorophenyl)methyl 4-(2-aminoethyl)-5,5-dimethylhexanoate |
| SMILES | CC(C)(C)C(CCN)CCC(=O)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H26ClNO2/c1-17(2,3)14(10-11-19)6-9-16(20)21-12-13-4-7-15(18)8-5-13/h4-5,7-8,14H,6,9-12,19H2,1-3H3 |
| InChIKey | PLCJUJOVLXPWKM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |