About (4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate
(4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate (PubChem CID 82824446) has the molecular formula C16H24BrNO2
and a molecular weight of 342.28 g/mol. Its IUPAC name is (4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate.
Molecular Properties
| Compound Name | (4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate |
| PubChem CID | 82824446 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate |
| SMILES | CC(C)C(CCN)CCC(=O)OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H24BrNO2/c1-12(2)14(9-10-18)5-8-16(19)20-11-13-3-6-15(17)7-4-13/h3-4,6-7,12,14H,5,8-11,18H2,1-2H3 |
| InChIKey | TZBDOLWPMUVJKE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate?
The IUPAC name of (4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate (CID 82824446) is (4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate.
What is the SMILES notation for (4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate?
The canonical SMILES for (4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate is CC(C)C(CCN)CCC(=O)OCc1ccc(Br)cc1.
What is the InChIKey of (4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate?
The InChIKey is TZBDOLWPMUVJKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24BrNO2/c1-12(2)14(9-10-18)5-8-16(19)20-11-13-3-6-15(17)7-4-13/h3-4,6-7,12,14H,5,8-11,18H2,1-2H3.
What are the key properties of (4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate?
(4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate has a molecular weight of 342.28 g/mol, XLogP of 3.89, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)methyl 4-(2-aminoethyl)-5-methylhexanoate is sourced from PubChem (CID 82824446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).