About 2-ethoxybenzenesulfinic acid
2-ethoxybenzenesulfinic acid (PubChem CID 19828725) has the molecular formula C8H10O3S
and a molecular weight of 186.23 g/mol. Its IUPAC name is 2-ethoxybenzenesulfinic acid.
Molecular Properties
| Compound Name | 2-ethoxybenzenesulfinic acid |
| PubChem CID | 19828725 |
| Molecular Formula | C8H10O3S |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 2-ethoxybenzenesulfinic acid |
| SMILES | CCOc1ccccc1S(=O)O |
| InChI | InChI=1S/C8H10O3S/c1-2-11-7-5-3-4-6-8(7)12(9)10/h3-6H,2H2,1H3,(H,9,10) |
| InChIKey | BWCCOBQWEIDPNH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxybenzenesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxybenzenesulfinic acid?
The IUPAC name of 2-ethoxybenzenesulfinic acid (CID 19828725) is 2-ethoxybenzenesulfinic acid.
What is the SMILES notation for 2-ethoxybenzenesulfinic acid?
The canonical SMILES for 2-ethoxybenzenesulfinic acid is CCOc1ccccc1S(=O)O.
What is the InChIKey of 2-ethoxybenzenesulfinic acid?
The InChIKey is BWCCOBQWEIDPNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3S/c1-2-11-7-5-3-4-6-8(7)12(9)10/h3-6H,2H2,1H3,(H,9,10).
What are the key properties of 2-ethoxybenzenesulfinic acid?
2-ethoxybenzenesulfinic acid has a molecular weight of 186.23 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxybenzenesulfinic acid is sourced from PubChem (CID 19828725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).