2-ethoxybenzenesulfinic acid

C8H10O3S — CID 19828725

IUPAC2-ethoxybenzenesulfinic acid
SMILESCCOc1ccccc1S(=O)O
InChIInChI=1S/C8H10O3S/c1-2-11-7-5-3-4-6-8(7)12(9)10/h3-6H,2H2,1H3,(H,9,10)
InChIKeyBWCCOBQWEIDPNH-UHFFFAOYSA-N
MW186.23 g/mol
LogP1.67
Rot. Bonds3

About 2-ethoxybenzenesulfinic acid

2-ethoxybenzenesulfinic acid (PubChem CID 19828725) has the molecular formula C8H10O3S and a molecular weight of 186.23 g/mol. Its IUPAC name is 2-ethoxybenzenesulfinic acid.

Molecular Properties

Compound Name2-ethoxybenzenesulfinic acid
PubChem CID19828725
Molecular FormulaC8H10O3S
Molecular Weight186.23 g/mol
Exact Mass186.04
IUPAC Name2-ethoxybenzenesulfinic acid
SMILESCCOc1ccccc1S(=O)O
InChIInChI=1S/C8H10O3S/c1-2-11-7-5-3-4-6-8(7)12(9)10/h3-6H,2H2,1H3,(H,9,10)
InChIKeyBWCCOBQWEIDPNH-UHFFFAOYSA-N
XLogP1.67
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.23
LogP ≤ 51.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 2-ethoxybenzenesulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxybenzenesulfinic acid?
The IUPAC name of 2-ethoxybenzenesulfinic acid (CID 19828725) is 2-ethoxybenzenesulfinic acid.
What is the SMILES notation for 2-ethoxybenzenesulfinic acid?
The canonical SMILES for 2-ethoxybenzenesulfinic acid is CCOc1ccccc1S(=O)O.
What is the InChIKey of 2-ethoxybenzenesulfinic acid?
The InChIKey is BWCCOBQWEIDPNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3S/c1-2-11-7-5-3-4-6-8(7)12(9)10/h3-6H,2H2,1H3,(H,9,10).
What are the key properties of 2-ethoxybenzenesulfinic acid?
2-ethoxybenzenesulfinic acid has a molecular weight of 186.23 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxybenzenesulfinic acid is sourced from PubChem (CID 19828725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).