C12H17N4OS2+ — CID 19831257
1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one (PubChem CID 19831257) has the molecular formula C12H17N4OS2+ and a molecular weight of 297.43 g/mol. Its IUPAC name is 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one.
| Compound Name | 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one |
|---|---|
| PubChem CID | 19831257 |
| Molecular Formula | C12H17N4OS2+ |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-methylimidazol-2-yl)sulfanylpropan-2-one |
| SMILES | Cn1ccnc1SCC(=O)CSc1n(C)cc[n+]1C |
| InChI | InChI=1S/C12H17N4OS2/c1-14-5-4-13-11(14)18-8-10(17)9-19-12-15(2)6-7-16(12)3/h4-7H,8-9H2,1-3H3/q+1 |
| InChIKey | VZJFTIZTPSEEFF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|