C10H9ClFN3O2 — CID 19832742
4-chloro-2-fluoro-5-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]aniline (PubChem CID 19832742) has the molecular formula C10H9ClFN3O2 and a molecular weight of 257.65 g/mol. Its IUPAC name is 4-chloro-2-fluoro-5-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]aniline.
| Compound Name | 4-chloro-2-fluoro-5-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]aniline |
|---|---|
| PubChem CID | 19832742 |
| Molecular Formula | C10H9ClFN3O2 |
| Molecular Weight | 257.65 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 4-chloro-2-fluoro-5-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]aniline |
| SMILES | Cc1nonc1COc1cc(N)c(F)cc1Cl |
| InChI | InChI=1S/C10H9ClFN3O2/c1-5-9(15-17-14-5)4-16-10-3-8(13)7(12)2-6(10)11/h2-3H,4,13H2,1H3 |
| InChIKey | FHZNOJBHOZDSHF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.65 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|