C4H7N3O2 — CID 79422234
O-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]hydroxylamine (PubChem CID 79422234) has the molecular formula C4H7N3O2 and a molecular weight of 129.12 g/mol. Its IUPAC name is O-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]hydroxylamine.
| Compound Name | O-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 79422234 |
| Molecular Formula | C4H7N3O2 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | O-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]hydroxylamine |
| SMILES | Cc1nonc1CON |
| InChI | InChI=1S/C4H7N3O2/c1-3-4(2-8-5)7-9-6-3/h2,5H2,1H3 |
| InChIKey | WQDWZRZKYTZYGL-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|