About diethyl-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azanium
diethyl-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azanium (PubChem CID 6946224) has the molecular formula C8H16N3O+
and a molecular weight of 170.24 g/mol. Its IUPAC name is diethyl-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azanium.
Analyze diethyl-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azanium?
The IUPAC name of diethyl-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azanium (CID 6946224) is diethyl-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azanium.
What is the SMILES notation for diethyl-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azanium?
The canonical SMILES for diethyl-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azanium is CC[NH+](CC)Cc1nonc1C.
What is the InChIKey of diethyl-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azanium?
The InChIKey is YHIIXCRCOYDICX-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H15N3O/c1-4-11(5-2)6-8-7(3)9-12-10-8/h4-6H2,1-3H3/p+1.
What are the key properties of diethyl-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azanium?
diethyl-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azanium has a molecular weight of 170.24 g/mol, XLogP of -0.20, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azanium is sourced from PubChem (CID 6946224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).