About 3-(azidomethyl)-4-methyl-1,2,5-oxadiazole
3-(azidomethyl)-4-methyl-1,2,5-oxadiazole (PubChem CID 58766277) has the molecular formula C4H5N5O
and a molecular weight of 139.12 g/mol. Its IUPAC name is 3-(azidomethyl)-4-methyl-1,2,5-oxadiazole.
Molecular Properties
| Compound Name | 3-(azidomethyl)-4-methyl-1,2,5-oxadiazole |
| PubChem CID | 58766277 |
| Molecular Formula | C4H5N5O |
| Molecular Weight | 139.12 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 3-(azidomethyl)-4-methyl-1,2,5-oxadiazole |
| SMILES | Cc1nonc1CN=[N+]=[N-] |
| InChI | InChI=1S/C4H5N5O/c1-3-4(2-6-9-5)8-10-7-3/h2H2,1H3 |
| InChIKey | RQCHFGPUCXNOKX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 87.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.12 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(azidomethyl)-4-methyl-1,2,5-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(azidomethyl)-4-methyl-1,2,5-oxadiazole?
The IUPAC name of 3-(azidomethyl)-4-methyl-1,2,5-oxadiazole (CID 58766277) is 3-(azidomethyl)-4-methyl-1,2,5-oxadiazole.
What is the SMILES notation for 3-(azidomethyl)-4-methyl-1,2,5-oxadiazole?
The canonical SMILES for 3-(azidomethyl)-4-methyl-1,2,5-oxadiazole is Cc1nonc1CN=[N+]=[N-].
What is the InChIKey of 3-(azidomethyl)-4-methyl-1,2,5-oxadiazole?
The InChIKey is RQCHFGPUCXNOKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N5O/c1-3-4(2-6-9-5)8-10-7-3/h2H2,1H3.
What are the key properties of 3-(azidomethyl)-4-methyl-1,2,5-oxadiazole?
3-(azidomethyl)-4-methyl-1,2,5-oxadiazole has a molecular weight of 139.12 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(azidomethyl)-4-methyl-1,2,5-oxadiazole is sourced from PubChem (CID 58766277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).