C5H6N6O2 — CID 136647801
(NZ)-N-[2-azido-1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylidene]hydroxylamine (PubChem CID 136647801) has the molecular formula C5H6N6O2 and a molecular weight of 182.14 g/mol. Its IUPAC name is (NZ)-N-[2-azido-1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[2-azido-1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 136647801 |
| Molecular Formula | C5H6N6O2 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (NZ)-N-[2-azido-1-(4-methyl-1,2,5-oxadiazol-3-yl)ethylidene]hydroxylamine |
| SMILES | Cc1nonc1/C(CN=[N+]=[N-])=N\O |
| InChI | InChI=1S/C5H6N6O2/c1-3-5(10-13-9-3)4(8-12)2-7-11-6/h12H,2H2,1H3/b8-4- |
| InChIKey | SKEITELSGUMYGS-YWEYNIOJSA-N |
| XLogP | 0.87 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|