About 2-(azidomethyl)penta-1,4-diene
2-(azidomethyl)penta-1,4-diene (PubChem CID 23453433) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 2-(azidomethyl)penta-1,4-diene.
Molecular Properties
| Compound Name | 2-(azidomethyl)penta-1,4-diene |
| PubChem CID | 23453433 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 2-(azidomethyl)penta-1,4-diene |
| SMILES | C=CCC(=C)CN=[N+]=[N-] |
| InChI | InChI=1S/C6H9N3/c1-3-4-6(2)5-8-9-7/h3H,1-2,4-5H2 |
| InChIKey | DDJVZWZGARGHSP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(azidomethyl)penta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azidomethyl)penta-1,4-diene?
The IUPAC name of 2-(azidomethyl)penta-1,4-diene (CID 23453433) is 2-(azidomethyl)penta-1,4-diene.
What is the SMILES notation for 2-(azidomethyl)penta-1,4-diene?
The canonical SMILES for 2-(azidomethyl)penta-1,4-diene is C=CCC(=C)CN=[N+]=[N-].
What is the InChIKey of 2-(azidomethyl)penta-1,4-diene?
The InChIKey is DDJVZWZGARGHSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c1-3-4-6(2)5-8-9-7/h3H,1-2,4-5H2.
What are the key properties of 2-(azidomethyl)penta-1,4-diene?
2-(azidomethyl)penta-1,4-diene has a molecular weight of 123.16 g/mol, XLogP of 2.43, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azidomethyl)penta-1,4-diene is sourced from PubChem (CID 23453433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).