About 3-azido-2-oxopropanal
3-azido-2-oxopropanal (PubChem CID 54201527) has the molecular formula C3H3N3O2
and a molecular weight of 113.08 g/mol. Its IUPAC name is 3-azido-2-oxopropanal.
Molecular Properties
| Compound Name | 3-azido-2-oxopropanal |
| PubChem CID | 54201527 |
| Molecular Formula | C3H3N3O2 |
| Molecular Weight | 113.08 g/mol |
| Exact Mass | 113.02 |
| IUPAC Name | 3-azido-2-oxopropanal |
| SMILES | [N-]=[N+]=NCC(=O)C=O |
| InChI | InChI=1S/C3H3N3O2/c4-6-5-1-3(8)2-7/h2H,1H2 |
| InChIKey | FCUVHQJQULHOJM-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.08 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-azido-2-oxopropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azido-2-oxopropanal?
The IUPAC name of 3-azido-2-oxopropanal (CID 54201527) is 3-azido-2-oxopropanal.
What is the SMILES notation for 3-azido-2-oxopropanal?
The canonical SMILES for 3-azido-2-oxopropanal is [N-]=[N+]=NCC(=O)C=O.
What is the InChIKey of 3-azido-2-oxopropanal?
The InChIKey is FCUVHQJQULHOJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N3O2/c4-6-5-1-3(8)2-7/h2H,1H2.
What are the key properties of 3-azido-2-oxopropanal?
3-azido-2-oxopropanal has a molecular weight of 113.08 g/mol, XLogP of 0.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azido-2-oxopropanal is sourced from PubChem (CID 54201527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).