About CID 162458828
CID 162458828 (PubChem CID 162458828) has the molecular formula C3H3N3O2
and a molecular weight of 113.08 g/mol.
Molecular Properties
| Compound Name | CID 162458828 |
| PubChem CID | 162458828 |
| Molecular Formula | C3H3N3O2 |
| Molecular Weight | 113.08 g/mol |
| Exact Mass | 113.02 |
| IUPAC Name | — |
| SMILES | [CH]OC(=O)CN=[N+]=[N-] |
| InChI | InChI=1S/C3H3N3O2/c1-8-3(7)2-5-6-4/h1H,2H2 |
| InChIKey | NVVSWQRNODDJIM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.08 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze CID 162458828 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162458828?
The IUPAC name of CID 162458828 (CID 162458828) is not available.
What is the SMILES notation for CID 162458828?
The canonical SMILES for CID 162458828 is [CH]OC(=O)CN=[N+]=[N-].
What is the InChIKey of CID 162458828?
The InChIKey is NVVSWQRNODDJIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N3O2/c1-8-3(7)2-5-6-4/h1H,2H2.
What are the key properties of CID 162458828?
CID 162458828 has a molecular weight of 113.08 g/mol, XLogP of 0.51, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162458828 is sourced from PubChem (CID 162458828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).