About 3-azidopropanoyl sulfite
3-azidopropanoyl sulfite (PubChem CID 174986930) has the molecular formula C3H4N3O4S-
and a molecular weight of 178.15 g/mol. Its IUPAC name is 3-azidopropanoyl sulfite.
Molecular Properties
| Compound Name | 3-azidopropanoyl sulfite |
| PubChem CID | 174986930 |
| Molecular Formula | C3H4N3O4S- |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 177.99 |
| IUPAC Name | 3-azidopropanoyl sulfite |
| SMILES | [N-]=[N+]=NCCC(=O)OS(=O)[O-] |
| InChI | InChI=1S/C3H5N3O4S/c4-6-5-2-1-3(7)10-11(8)9/h1-2H2,(H,8,9)/p-1 |
| InChIKey | HYISYXABSABMFY-UHFFFAOYSA-M |
| XLogP | 0.02 |
| TPSA | 115.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-azidopropanoyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azidopropanoyl sulfite?
The IUPAC name of 3-azidopropanoyl sulfite (CID 174986930) is 3-azidopropanoyl sulfite.
What is the SMILES notation for 3-azidopropanoyl sulfite?
The canonical SMILES for 3-azidopropanoyl sulfite is [N-]=[N+]=NCCC(=O)OS(=O)[O-].
What is the InChIKey of 3-azidopropanoyl sulfite?
The InChIKey is HYISYXABSABMFY-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H5N3O4S/c4-6-5-2-1-3(7)10-11(8)9/h1-2H2,(H,8,9)/p-1.
What are the key properties of 3-azidopropanoyl sulfite?
3-azidopropanoyl sulfite has a molecular weight of 178.15 g/mol, XLogP of 0.02, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azidopropanoyl sulfite is sourced from PubChem (CID 174986930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).