About 1-azidododec-11-ene-2,10-dione
1-azidododec-11-ene-2,10-dione (PubChem CID 167561319) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-azidododec-11-ene-2,10-dione.
Molecular Properties
| Compound Name | 1-azidododec-11-ene-2,10-dione |
| PubChem CID | 167561319 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-azidododec-11-ene-2,10-dione |
| SMILES | C=CC(=O)CCCCCCCC(=O)CN=[N+]=[N-] |
| InChI | InChI=1S/C12H19N3O2/c1-2-11(16)8-6-4-3-5-7-9-12(17)10-14-15-13/h2H,1,3-10H2 |
| InChIKey | VKKIBOBSAIHZHF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-azidododec-11-ene-2,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azidododec-11-ene-2,10-dione?
The IUPAC name of 1-azidododec-11-ene-2,10-dione (CID 167561319) is 1-azidododec-11-ene-2,10-dione.
What is the SMILES notation for 1-azidododec-11-ene-2,10-dione?
The canonical SMILES for 1-azidododec-11-ene-2,10-dione is C=CC(=O)CCCCCCCC(=O)CN=[N+]=[N-].
What is the InChIKey of 1-azidododec-11-ene-2,10-dione?
The InChIKey is VKKIBOBSAIHZHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-2-11(16)8-6-4-3-5-7-9-12(17)10-14-15-13/h2H,1,3-10H2.
What are the key properties of 1-azidododec-11-ene-2,10-dione?
1-azidododec-11-ene-2,10-dione has a molecular weight of 237.30 g/mol, XLogP of 3.35, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azidododec-11-ene-2,10-dione is sourced from PubChem (CID 167561319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).