C9H15N3O2 — CID 171469981
1-azido-6,6-dimethylheptane-2,5-dione (PubChem CID 171469981) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-azido-6,6-dimethylheptane-2,5-dione.
| Compound Name | 1-azido-6,6-dimethylheptane-2,5-dione |
|---|---|
| PubChem CID | 171469981 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-azido-6,6-dimethylheptane-2,5-dione |
| SMILES | CC(C)(C)C(=O)CCC(=O)CN=[N+]=[N-] |
| InChI | InChI=1S/C9H15N3O2/c1-9(2,3)8(14)5-4-7(13)6-11-12-10/h4-6H2,1-3H3 |
| InChIKey | UOMLZORLDJOJDZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|