About 2-azidoethanimidamide
2-azidoethanimidamide (PubChem CID 150332829) has the molecular formula C2H5N5
and a molecular weight of 99.10 g/mol. Its IUPAC name is 2-azidoethanimidamide.
Molecular Properties
| Compound Name | 2-azidoethanimidamide |
| PubChem CID | 150332829 |
| Molecular Formula | C2H5N5 |
| Molecular Weight | 99.10 g/mol |
| Exact Mass | 99.05 |
| IUPAC Name | 2-azidoethanimidamide |
| SMILES | [H]/N=C(/N)CN=[N+]=[N-] |
| InChI | InChI=1S/C2H5N5/c3-2(4)1-6-7-5/h1H2,(H3,3,4) |
| InChIKey | GQAUOBDRTWIZFT-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 98.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.10 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-azidoethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azidoethanimidamide?
The IUPAC name of 2-azidoethanimidamide (CID 150332829) is 2-azidoethanimidamide.
What is the SMILES notation for 2-azidoethanimidamide?
The canonical SMILES for 2-azidoethanimidamide is [H]/N=C(/N)CN=[N+]=[N-].
What is the InChIKey of 2-azidoethanimidamide?
The InChIKey is GQAUOBDRTWIZFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N5/c3-2(4)1-6-7-5/h1H2,(H3,3,4).
What are the key properties of 2-azidoethanimidamide?
2-azidoethanimidamide has a molecular weight of 99.10 g/mol, XLogP of 0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azidoethanimidamide is sourced from PubChem (CID 150332829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).