C10H14N4 — CID 20786572
5-(azidomethyl)-4-ethyl-2,3-dimethylpyridine (PubChem CID 20786572) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-(azidomethyl)-4-ethyl-2,3-dimethylpyridine.
| Compound Name | 5-(azidomethyl)-4-ethyl-2,3-dimethylpyridine |
|---|---|
| PubChem CID | 20786572 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 5-(azidomethyl)-4-ethyl-2,3-dimethylpyridine |
| SMILES | CCc1c(CN=[N+]=[N-])cnc(C)c1C |
| InChI | InChI=1S/C10H14N4/c1-4-10-7(2)8(3)12-5-9(10)6-13-14-11/h5H,4,6H2,1-3H3 |
| InChIKey | AAFPHGFNOFXSHF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|