C12H15Br2N3 — CID 141330509
1-(azidomethyl)-3,5-bis(bromomethyl)-2,4,6-trimethylbenzene (PubChem CID 141330509) has the molecular formula C12H15Br2N3 and a molecular weight of 361.08 g/mol. Its IUPAC name is 1-(azidomethyl)-3,5-bis(bromomethyl)-2,4,6-trimethylbenzene.
| Compound Name | 1-(azidomethyl)-3,5-bis(bromomethyl)-2,4,6-trimethylbenzene |
|---|---|
| PubChem CID | 141330509 |
| Molecular Formula | C12H15Br2N3 |
| Molecular Weight | 361.08 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 1-(azidomethyl)-3,5-bis(bromomethyl)-2,4,6-trimethylbenzene |
| SMILES | Cc1c(CBr)c(C)c(CN=[N+]=[N-])c(C)c1CBr |
| InChI | InChI=1S/C12H15Br2N3/c1-7-10(4-13)8(2)12(6-16-17-15)9(3)11(7)5-14/h4-6H2,1-3H3 |
| InChIKey | FMNSPKNSDWARBM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.08 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|