C10H12BrN3O — CID 117109212
2-(azidomethyl)-4-bromo-3,5,6-trimethylphenol (PubChem CID 117109212) has the molecular formula C10H12BrN3O and a molecular weight of 270.13 g/mol. Its IUPAC name is 2-(azidomethyl)-4-bromo-3,5,6-trimethylphenol.
| Compound Name | 2-(azidomethyl)-4-bromo-3,5,6-trimethylphenol |
|---|---|
| PubChem CID | 117109212 |
| Molecular Formula | C10H12BrN3O |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 2-(azidomethyl)-4-bromo-3,5,6-trimethylphenol |
| SMILES | Cc1c(C)c(Br)c(C)c(CN=[N+]=[N-])c1O |
| InChI | InChI=1S/C10H12BrN3O/c1-5-6(2)10(15)8(4-13-14-12)7(3)9(5)11/h15H,4H2,1-3H3 |
| InChIKey | FDSVFPLLECJAJJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|