C7H2F5N3 — CID 6424875
1-(azidomethyl)-2,3,4,5,6-pentafluorobenzene (PubChem CID 6424875) has the molecular formula C7H2F5N3 and a molecular weight of 223.10 g/mol. Its IUPAC name is 1-(azidomethyl)-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-(azidomethyl)-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 6424875 |
| Molecular Formula | C7H2F5N3 |
| Molecular Weight | 223.10 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 1-(azidomethyl)-2,3,4,5,6-pentafluorobenzene |
| SMILES | [N-]=[N+]=NCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7H2F5N3/c8-3-2(1-14-15-13)4(9)6(11)7(12)5(3)10/h1H2 |
| InChIKey | PMKKKTQBUGNJPJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.10 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|