C8H2F5N3 — CID 155327745
5-(azidomethyl)-1,3,4,6,7-pentafluorocyclohepta-1,2,4,6-tetraene (PubChem CID 155327745) has the molecular formula C8H2F5N3 and a molecular weight of 235.11 g/mol. Its IUPAC name is 5-(azidomethyl)-1,3,4,6,7-pentafluorocyclohepta-1,2,4,6-tetraene.
| Compound Name | 5-(azidomethyl)-1,3,4,6,7-pentafluorocyclohepta-1,2,4,6-tetraene |
|---|---|
| PubChem CID | 155327745 |
| Molecular Formula | C8H2F5N3 |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 5-(azidomethyl)-1,3,4,6,7-pentafluorocyclohepta-1,2,4,6-tetraene |
| SMILES | [N-]=[N+]=NCC1=C(F)C(F)=C=C(F)C(F)=C1F |
| InChI | InChI=1S/C8H2F5N3/c9-4-1-5(10)8(13)7(12)3(6(4)11)2-15-16-14/h2H2 |
| InChIKey | VRLSPXYVAGYRDV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|