C8H6N6O2 — CID 140605602
2,5-bis(azidomethyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 140605602) has the molecular formula C8H6N6O2 and a molecular weight of 218.18 g/mol. Its IUPAC name is 2,5-bis(azidomethyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis(azidomethyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 140605602 |
| Molecular Formula | C8H6N6O2 |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2,5-bis(azidomethyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | [N-]=[N+]=NCC1=CC(=O)C(CN=[N+]=[N-])=CC1=O |
| InChI | InChI=1S/C8H6N6O2/c9-13-11-3-5-1-7(15)6(2-8(5)16)4-12-14-10/h1-2H,3-4H2 |
| InChIKey | WXLOIANLECIMNU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 131.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|