About 3-(2-azidoethyl)furan-2,5-dione
3-(2-azidoethyl)furan-2,5-dione (PubChem CID 134248877) has the molecular formula C6H5N3O3
and a molecular weight of 167.12 g/mol. Its IUPAC name is 3-(2-azidoethyl)furan-2,5-dione.
Molecular Properties
| Compound Name | 3-(2-azidoethyl)furan-2,5-dione |
| PubChem CID | 134248877 |
| Molecular Formula | C6H5N3O3 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 3-(2-azidoethyl)furan-2,5-dione |
| SMILES | [N-]=[N+]=NCCC1=CC(=O)OC1=O |
| InChI | InChI=1S/C6H5N3O3/c7-9-8-2-1-4-3-5(10)12-6(4)11/h3H,1-2H2 |
| InChIKey | YIWVJSUNKSDLTB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-azidoethyl)furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-azidoethyl)furan-2,5-dione?
The IUPAC name of 3-(2-azidoethyl)furan-2,5-dione (CID 134248877) is 3-(2-azidoethyl)furan-2,5-dione.
What is the SMILES notation for 3-(2-azidoethyl)furan-2,5-dione?
The canonical SMILES for 3-(2-azidoethyl)furan-2,5-dione is [N-]=[N+]=NCCC1=CC(=O)OC1=O.
What is the InChIKey of 3-(2-azidoethyl)furan-2,5-dione?
The InChIKey is YIWVJSUNKSDLTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O3/c7-9-8-2-1-4-3-5(10)12-6(4)11/h3H,1-2H2.
What are the key properties of 3-(2-azidoethyl)furan-2,5-dione?
3-(2-azidoethyl)furan-2,5-dione has a molecular weight of 167.12 g/mol, XLogP of 0.70, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-azidoethyl)furan-2,5-dione is sourced from PubChem (CID 134248877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).