C7H11N3O2 — CID 141258905
4-(2-azidoethyl)-2,2-dimethyl-1,3-dioxole (PubChem CID 141258905) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-(2-azidoethyl)-2,2-dimethyl-1,3-dioxole.
| Compound Name | 4-(2-azidoethyl)-2,2-dimethyl-1,3-dioxole |
|---|---|
| PubChem CID | 141258905 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4-(2-azidoethyl)-2,2-dimethyl-1,3-dioxole |
| SMILES | CC1(C)OC=C(CCN=[N+]=[N-])O1 |
| InChI | InChI=1S/C7H11N3O2/c1-7(2)11-5-6(12-7)3-4-9-10-8/h5H,3-4H2,1-2H3 |
| InChIKey | KZQAKERNLSOPHK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|