C10H14N2O5 — CID 103973905
3-ethoxy-2-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-3-oxopropanoic acid (PubChem CID 103973905) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is 3-ethoxy-2-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-3-oxopropanoic acid.
| Compound Name | 3-ethoxy-2-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 103973905 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-ethoxy-2-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-3-oxopropanoic acid |
| SMILES | CCOC(=O)C(C)(Cc1nonc1C)C(=O)O |
| InChI | InChI=1S/C10H14N2O5/c1-4-16-9(15)10(3,8(13)14)5-7-6(2)11-17-12-7/h4-5H2,1-3H3,(H,13,14) |
| InChIKey | OBAGBEICDOTOIG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|