C11H13ClN2O4 — CID 112751497
2-[(2-chloropyrimidin-4-yl)methyl]-3-ethoxy-2-methyl-3-oxopropanoic acid (PubChem CID 112751497) has the molecular formula C11H13ClN2O4 and a molecular weight of 272.69 g/mol. Its IUPAC name is 2-[(2-chloropyrimidin-4-yl)methyl]-3-ethoxy-2-methyl-3-oxopropanoic acid.
| Compound Name | 2-[(2-chloropyrimidin-4-yl)methyl]-3-ethoxy-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 112751497 |
| Molecular Formula | C11H13ClN2O4 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-[(2-chloropyrimidin-4-yl)methyl]-3-ethoxy-2-methyl-3-oxopropanoic acid |
| SMILES | CCOC(=O)C(C)(Cc1ccnc(Cl)n1)C(=O)O |
| InChI | InChI=1S/C11H13ClN2O4/c1-3-18-9(17)11(2,8(15)16)6-7-4-5-13-10(12)14-7/h4-5H,3,6H2,1-2H3,(H,15,16) |
| InChIKey | BXIBLWDHJXUIDM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|