C11H10ClN3O3 — CID 82786561
(4-methyl-1,2,5-oxadiazol-3-yl)methyl 4-amino-3-chlorobenzoate (PubChem CID 82786561) has the molecular formula C11H10ClN3O3 and a molecular weight of 267.67 g/mol. Its IUPAC name is (4-methyl-1,2,5-oxadiazol-3-yl)methyl 4-amino-3-chlorobenzoate.
| Compound Name | (4-methyl-1,2,5-oxadiazol-3-yl)methyl 4-amino-3-chlorobenzoate |
|---|---|
| PubChem CID | 82786561 |
| Molecular Formula | C11H10ClN3O3 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | (4-methyl-1,2,5-oxadiazol-3-yl)methyl 4-amino-3-chlorobenzoate |
| SMILES | Cc1nonc1COC(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C11H10ClN3O3/c1-6-10(15-18-14-6)5-17-11(16)7-2-3-9(13)8(12)4-7/h2-4H,5,13H2,1H3 |
| InChIKey | FADRUTCNIQOKSO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|