About (5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate
(5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate (PubChem CID 78998257) has the molecular formula C12H9BrClNO2S
and a molecular weight of 346.63 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate.
Molecular Properties
| Compound Name | (5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate |
| PubChem CID | 78998257 |
| Molecular Formula | C12H9BrClNO2S |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 344.92 |
| IUPAC Name | (5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate |
| SMILES | Nc1ccc(C(=O)OCc2ccc(Br)s2)cc1Cl |
| InChI | InChI=1S/C12H9BrClNO2S/c13-11-4-2-8(18-11)6-17-12(16)7-1-3-10(15)9(14)5-7/h1-5H,6,15H2 |
| InChIKey | FTSQZQKGBIDKKS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate?
The IUPAC name of (5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate (CID 78998257) is (5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate.
What is the SMILES notation for (5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate?
The canonical SMILES for (5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate is Nc1ccc(C(=O)OCc2ccc(Br)s2)cc1Cl.
What is the InChIKey of (5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate?
The InChIKey is FTSQZQKGBIDKKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrClNO2S/c13-11-4-2-8(18-11)6-17-12(16)7-1-3-10(15)9(14)5-7/h1-5H,6,15H2.
What are the key properties of (5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate?
(5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate has a molecular weight of 346.63 g/mol, XLogP of 4.10, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromothiophen-2-yl)methyl 4-amino-3-chlorobenzoate is sourced from PubChem (CID 78998257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).