C18H20Cl2N2O2 — CID 19834547
1-[3-(3,4-dichlorophenyl)propyl]-3-methoxy-3-methyl-1-phenylurea (PubChem CID 19834547) has the molecular formula C18H20Cl2N2O2 and a molecular weight of 367.28 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)propyl]-3-methoxy-3-methyl-1-phenylurea.
| Compound Name | 1-[3-(3,4-dichlorophenyl)propyl]-3-methoxy-3-methyl-1-phenylurea |
|---|---|
| PubChem CID | 19834547 |
| Molecular Formula | C18H20Cl2N2O2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)propyl]-3-methoxy-3-methyl-1-phenylurea |
| SMILES | CON(C)C(=O)N(CCCc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C18H20Cl2N2O2/c1-21(24-2)18(23)22(15-8-4-3-5-9-15)12-6-7-14-10-11-16(19)17(20)13-14/h3-5,8-11,13H,6-7,12H2,1-2H3 |
| InChIKey | SWDZBMYGNDAWSB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|