C20H31N3O2S — CID 88846123
1-butyl-3-methoxy-3-methyl-1-[3-[2-methylprop-2-enyl(propanethioyl)amino]phenyl]urea (PubChem CID 88846123) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is 1-butyl-3-methoxy-3-methyl-1-[3-[2-methylprop-2-enyl(propanethioyl)amino]phenyl]urea.
| Compound Name | 1-butyl-3-methoxy-3-methyl-1-[3-[2-methylprop-2-enyl(propanethioyl)amino]phenyl]urea |
|---|---|
| PubChem CID | 88846123 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-butyl-3-methoxy-3-methyl-1-[3-[2-methylprop-2-enyl(propanethioyl)amino]phenyl]urea |
| SMILES | C=C(C)CN(C(=S)CC)c1cccc(N(CCCC)C(=O)N(C)OC)c1 |
| InChI | InChI=1S/C20H31N3O2S/c1-7-9-13-22(20(24)21(5)25-6)17-11-10-12-18(14-17)23(15-16(3)4)19(26)8-2/h10-12,14H,3,7-9,13,15H2,1-2,4-6H3 |
| InChIKey | LVVJBPYHGSRXBE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|