C28H36N2O3 — CID 19838282
3-(4-hydroxyphenyl)-4-[2-[6-(2-phenylethylamino)hexylamino]ethyl]benzene-1,2-diol (PubChem CID 19838282) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-4-[2-[6-(2-phenylethylamino)hexylamino]ethyl]benzene-1,2-diol.
| Compound Name | 3-(4-hydroxyphenyl)-4-[2-[6-(2-phenylethylamino)hexylamino]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 19838282 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 3-(4-hydroxyphenyl)-4-[2-[6-(2-phenylethylamino)hexylamino]ethyl]benzene-1,2-diol |
| SMILES | Oc1ccc(-c2c(CCNCCCCCCNCCc3ccccc3)ccc(O)c2O)cc1 |
| InChI | InChI=1S/C28H36N2O3/c31-25-13-10-23(11-14-25)27-24(12-15-26(32)28(27)33)17-21-30-19-7-2-1-6-18-29-20-16-22-8-4-3-5-9-22/h3-5,8-15,29-33H,1-2,6-7,16-21H2 |
| InChIKey | AQYITVKNWSCDCQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|