C30H39FN2O4 — CID 23043911
4-[2-[6-[2-(3-fluoro-4-hydroxyphenyl)ethylamino]hexylamino]ethyl]-3-[2-(3-hydroxyphenyl)ethyl]benzene-1,2-diol (PubChem CID 23043911) has the molecular formula C30H39FN2O4 and a molecular weight of 510.65 g/mol. Its IUPAC name is 4-[2-[6-[2-(3-fluoro-4-hydroxyphenyl)ethylamino]hexylamino]ethyl]-3-[2-(3-hydroxyphenyl)ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-[6-[2-(3-fluoro-4-hydroxyphenyl)ethylamino]hexylamino]ethyl]-3-[2-(3-hydroxyphenyl)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 23043911 |
| Molecular Formula | C30H39FN2O4 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 4-[2-[6-[2-(3-fluoro-4-hydroxyphenyl)ethylamino]hexylamino]ethyl]-3-[2-(3-hydroxyphenyl)ethyl]benzene-1,2-diol |
| SMILES | Oc1cccc(CCc2c(CCNCCCCCCNCCc3ccc(O)c(F)c3)ccc(O)c2O)c1 |
| InChI | InChI=1S/C30H39FN2O4/c31-27-21-23(9-12-28(27)35)14-18-32-16-3-1-2-4-17-33-19-15-24-10-13-29(36)30(37)26(24)11-8-22-6-5-7-25(34)20-22/h5-7,9-10,12-13,20-21,32-37H,1-4,8,11,14-19H2 |
| InChIKey | ZJWZSYQISOJONF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|