C30H39ClN2O3 — CID 23043939
3-[2-(3-chlorophenyl)ethyl]-4-[2-[6-[2-(4-hydroxyphenyl)ethylamino]hexylamino]ethyl]benzene-1,2-diol (PubChem CID 23043939) has the molecular formula C30H39ClN2O3 and a molecular weight of 511.11 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)ethyl]-4-[2-[6-[2-(4-hydroxyphenyl)ethylamino]hexylamino]ethyl]benzene-1,2-diol.
| Compound Name | 3-[2-(3-chlorophenyl)ethyl]-4-[2-[6-[2-(4-hydroxyphenyl)ethylamino]hexylamino]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 23043939 |
| Molecular Formula | C30H39ClN2O3 |
| Molecular Weight | 511.11 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 3-[2-(3-chlorophenyl)ethyl]-4-[2-[6-[2-(4-hydroxyphenyl)ethylamino]hexylamino]ethyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CCNCCCCCCNCCc2ccc(O)c(O)c2CCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C30H39ClN2O3/c31-26-7-5-6-24(22-26)10-14-28-25(11-15-29(35)30(28)36)17-21-33-19-4-2-1-3-18-32-20-16-23-8-12-27(34)13-9-23/h5-9,11-13,15,22,32-36H,1-4,10,14,16-21H2 |
| InChIKey | FBFAOQHEJPIWCR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.11 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|