C19H21N3O5S — CID 19844106
2-[5-[(4-ethoxyphenyl)sulfamoyl]-1H-indol-3-yl]ethylcarbamic acid (PubChem CID 19844106) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is 2-[5-[(4-ethoxyphenyl)sulfamoyl]-1H-indol-3-yl]ethylcarbamic acid.
| Compound Name | 2-[5-[(4-ethoxyphenyl)sulfamoyl]-1H-indol-3-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 19844106 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-[5-[(4-ethoxyphenyl)sulfamoyl]-1H-indol-3-yl]ethylcarbamic acid |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc3[nH]cc(CCNC(=O)O)c3c2)cc1 |
| InChI | InChI=1S/C19H21N3O5S/c1-2-27-15-5-3-14(4-6-15)22-28(25,26)16-7-8-18-17(11-16)13(12-21-18)9-10-20-19(23)24/h3-8,11-12,20-22H,2,9-10H2,1H3,(H,23,24) |
| InChIKey | ZUDDPSLUGBCGIM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |