C15H18O2 — CID 19844365
1-(6-methoxy-5,8-dimethylnaphthalen-2-yl)ethanol (PubChem CID 19844365) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(6-methoxy-5,8-dimethylnaphthalen-2-yl)ethanol.
| Compound Name | 1-(6-methoxy-5,8-dimethylnaphthalen-2-yl)ethanol |
|---|---|
| PubChem CID | 19844365 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-(6-methoxy-5,8-dimethylnaphthalen-2-yl)ethanol |
| SMILES | COc1cc(C)c2cc(C(C)O)ccc2c1C |
| InChI | InChI=1S/C15H18O2/c1-9-7-15(17-4)10(2)13-6-5-12(11(3)16)8-14(9)13/h5-8,11,16H,1-4H3 |
| InChIKey | MBDQTSIAIHLCGP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |