C21H18F2I2N2O2S — CID 19844916
N-[[2,6-bis(fluoromethyl)phenyl]methyl]-2,5-diiodo-N-(pyridin-3-ylmethyl)benzenesulfonamide (PubChem CID 19844916) has the molecular formula C21H18F2I2N2O2S and a molecular weight of 654.26 g/mol. Its IUPAC name is N-[[2,6-bis(fluoromethyl)phenyl]methyl]-2,5-diiodo-N-(pyridin-3-ylmethyl)benzenesulfonamide.
| Compound Name | N-[[2,6-bis(fluoromethyl)phenyl]methyl]-2,5-diiodo-N-(pyridin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 19844916 |
| Molecular Formula | C21H18F2I2N2O2S |
| Molecular Weight | 654.26 g/mol |
| Exact Mass | 653.91 |
| IUPAC Name | N-[[2,6-bis(fluoromethyl)phenyl]methyl]-2,5-diiodo-N-(pyridin-3-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1cc(I)ccc1I)N(Cc1cccnc1)Cc1c(CF)cccc1CF |
| InChI | InChI=1S/C21H18F2I2N2O2S/c22-10-16-4-1-5-17(11-23)19(16)14-27(13-15-3-2-8-26-12-15)30(28,29)21-9-18(24)6-7-20(21)25/h1-9,12H,10-11,13-14H2 |
| InChIKey | JGLLBFIWBUDJDH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.26 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|