About [4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate
[4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate (PubChem CID 19845067) has the molecular formula C15H14N4O4
and a molecular weight of 314.30 g/mol. Its IUPAC name is [4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate.
Molecular Properties
| Compound Name | [4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate |
| PubChem CID | 19845067 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | [4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate |
| SMILES | NNC(=O)Oc1ccc(NC(=O)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C15H14N4O4/c16-19-15(22)23-12-8-6-11(7-9-12)18-14(21)13(20)17-10-4-2-1-3-5-10/h1-9H,16H2,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | LSWVSJMFFFPFFW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate?
The IUPAC name of [4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate (CID 19845067) is [4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate.
What is the SMILES notation for [4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate?
The canonical SMILES for [4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate is NNC(=O)Oc1ccc(NC(=O)C(=O)Nc2ccccc2)cc1.
What is the InChIKey of [4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate?
The InChIKey is LSWVSJMFFFPFFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O4/c16-19-15(22)23-12-8-6-11(7-9-12)18-14(21)13(20)17-10-4-2-1-3-5-10/h1-9H,16H2,(H,17,20)(H,18,21)(H,19,22).
What are the key properties of [4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate?
[4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate has a molecular weight of 314.30 g/mol, XLogP of 1.23, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2-anilino-2-oxoacetyl)amino]phenyl] N-aminocarbamate is sourced from PubChem (CID 19845067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).