C39H51ClO3 — CID 19847055
[4-(4-nonoxyphenyl)phenyl] 3-chloro-4-(4-pentylcyclohexyl)benzoate (PubChem CID 19847055) has the molecular formula C39H51ClO3 and a molecular weight of 603.29 g/mol. Its IUPAC name is [4-(4-nonoxyphenyl)phenyl] 3-chloro-4-(4-pentylcyclohexyl)benzoate.
| Compound Name | [4-(4-nonoxyphenyl)phenyl] 3-chloro-4-(4-pentylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 19847055 |
| Molecular Formula | C39H51ClO3 |
| Molecular Weight | 603.29 g/mol |
| Exact Mass | 602.35 |
| IUPAC Name | [4-(4-nonoxyphenyl)phenyl] 3-chloro-4-(4-pentylcyclohexyl)benzoate |
| SMILES | CCCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(C4CCC(CCCCC)CC4)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C39H51ClO3/c1-3-5-7-8-9-10-12-28-42-35-23-18-31(19-24-35)32-20-25-36(26-21-32)43-39(41)34-22-27-37(38(40)29-34)33-16-14-30(15-17-33)13-11-6-4-2/h18-27,29-30,33H,3-17,28H2,1-2H3 |
| InChIKey | XGGAVRNVETWJNZ-UHFFFAOYSA-N |
| XLogP | 12.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.29 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|