C79H104Cl2O6 — CID 88640337
[4-(4-octoxyphenyl)phenyl] 3-chloro-4-(4-heptylcyclohexyl)benzoate;[4-(4-octoxyphenyl)phenyl] 3-chloro-4-(4-hexylcyclohexyl)benzoate (PubChem CID 88640337) has the molecular formula C79H104Cl2O6 and a molecular weight of 1220.60 g/mol. Its IUPAC name is [4-(4-octoxyphenyl)phenyl] 3-chloro-4-(4-heptylcyclohexyl)benzoate;[4-(4-octoxyphenyl)phenyl] 3-chloro-4-(4-hexylcyclohexyl)benzoate.
| Compound Name | [4-(4-octoxyphenyl)phenyl] 3-chloro-4-(4-heptylcyclohexyl)benzoate;[4-(4-octoxyphenyl)phenyl] 3-chloro-4-(4-hexylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 88640337 |
| Molecular Formula | C79H104Cl2O6 |
| Molecular Weight | 1220.60 g/mol |
| Exact Mass | 1218.72 |
| IUPAC Name | [4-(4-octoxyphenyl)phenyl] 3-chloro-4-(4-heptylcyclohexyl)benzoate;[4-(4-octoxyphenyl)phenyl] 3-chloro-4-(4-hexylcyclohexyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(C4CCC(CCCCCC)CC4)c(Cl)c3)cc2)cc1.CCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(C4CCC(CCCCCCC)CC4)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C40H53ClO3.C39H51ClO3/c1-3-5-7-9-11-13-29-43-36-24-19-32(20-25-36)33-21-26-37(27-22-33)44-40(42)35-23-28-38(39(41)30-35)34-17-15-31(16-18-34)14-12-10-8-6-4-2;1-3-5-7-9-10-12-28-42-35-23-18-31(19-24-35)32-20-25-36(26-21-32)43-39(41)34-22-27-37(38(40)29-34)33-16-14-30(15-17-33)13-11-8-6-4-2/h19-28,30-31,34H,3-18,29H2,1-2H3;18-27,29-30,33H,3-17,28H2,1-2H3 |
| InChIKey | KMJBVMJCGJRJBM-UHFFFAOYSA-N |
| XLogP | 24.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1220.60 |
| LogP ≤ 5 | 24.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|