C28H28O5S — CID 19847884
3-(5-benzoyloxy-6-tert-butyl-1,3-benzoxathiol-2-yl)propyl benzoate (PubChem CID 19847884) has the molecular formula C28H28O5S and a molecular weight of 476.59 g/mol. Its IUPAC name is 3-(5-benzoyloxy-6-tert-butyl-1,3-benzoxathiol-2-yl)propyl benzoate.
| Compound Name | 3-(5-benzoyloxy-6-tert-butyl-1,3-benzoxathiol-2-yl)propyl benzoate |
|---|---|
| PubChem CID | 19847884 |
| Molecular Formula | C28H28O5S |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 3-(5-benzoyloxy-6-tert-butyl-1,3-benzoxathiol-2-yl)propyl benzoate |
| SMILES | CC(C)(C)c1cc2c(cc1OC(=O)c1ccccc1)SC(CCCOC(=O)c1ccccc1)O2 |
| InChI | InChI=1S/C28H28O5S/c1-28(2,3)21-17-23-24(18-22(21)33-27(30)20-13-8-5-9-14-20)34-25(32-23)15-10-16-31-26(29)19-11-6-4-7-12-19/h4-9,11-14,17-18,25H,10,15-16H2,1-3H3 |
| InChIKey | OTCLAARDUJGZHO-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|