C23H22O4 — CID 19849502
16-(4-methoxyphenoxy)hexadeca-5,8,11,14-tetraynoic acid (PubChem CID 19849502) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 16-(4-methoxyphenoxy)hexadeca-5,8,11,14-tetraynoic acid.
| Compound Name | 16-(4-methoxyphenoxy)hexadeca-5,8,11,14-tetraynoic acid |
|---|---|
| PubChem CID | 19849502 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 16-(4-methoxyphenoxy)hexadeca-5,8,11,14-tetraynoic acid |
| SMILES | COc1ccc(OCC#CCC#CCC#CCC#CCCCC(=O)O)cc1 |
| InChI | InChI=1S/C23H22O4/c1-26-21-16-18-22(19-17-21)27-20-14-12-10-8-6-4-2-3-5-7-9-11-13-15-23(24)25/h16-19H,4-5,10-11,13,15,20H2,1H3,(H,24,25) |
| InChIKey | DOTNGQUAXSMLPJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|