C14H13F2N3O4S — CID 19850887
3-(2,4-difluorophenoxy)-N'-hydroxy-4-(methanesulfonamido)benzenecarboximidamide (PubChem CID 19850887) has the molecular formula C14H13F2N3O4S and a molecular weight of 357.34 g/mol. Its IUPAC name is 3-(2,4-difluorophenoxy)-N'-hydroxy-4-(methanesulfonamido)benzenecarboximidamide.
| Compound Name | 3-(2,4-difluorophenoxy)-N'-hydroxy-4-(methanesulfonamido)benzenecarboximidamide |
|---|---|
| PubChem CID | 19850887 |
| Molecular Formula | C14H13F2N3O4S |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 3-(2,4-difluorophenoxy)-N'-hydroxy-4-(methanesulfonamido)benzenecarboximidamide |
| SMILES | CS(=O)(=O)Nc1ccc(/C(N)=N/O)cc1Oc1ccc(F)cc1F |
| InChI | InChI=1S/C14H13F2N3O4S/c1-24(21,22)19-11-4-2-8(14(17)18-20)6-13(11)23-12-5-3-9(15)7-10(12)16/h2-7,19-20H,1H3,(H2,17,18) |
| InChIKey | AGKZAOFCJQWCNY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|