C16H16F2N4O3S2 — CID 11742516
[(E)-1-[3-(2,4-difluorophenoxy)-4-(methanesulfonamido)phenyl]ethylideneamino]thiourea (PubChem CID 11742516) has the molecular formula C16H16F2N4O3S2 and a molecular weight of 414.46 g/mol. Its IUPAC name is [(E)-1-[3-(2,4-difluorophenoxy)-4-(methanesulfonamido)phenyl]ethylideneamino]thiourea.
| Compound Name | [(E)-1-[3-(2,4-difluorophenoxy)-4-(methanesulfonamido)phenyl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 11742516 |
| Molecular Formula | C16H16F2N4O3S2 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | [(E)-1-[3-(2,4-difluorophenoxy)-4-(methanesulfonamido)phenyl]ethylideneamino]thiourea |
| SMILES | C/C(=N\NC(N)=S)c1ccc(NS(C)(=O)=O)c(Oc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C16H16F2N4O3S2/c1-9(20-21-16(19)26)10-3-5-13(22-27(2,23)24)15(7-10)25-14-6-4-11(17)8-12(14)18/h3-8,22H,1-2H3,(H3,19,21,26)/b20-9+ |
| InChIKey | YYNMDZNDGDYCTD-AWQFTUOYSA-N |
| XLogP | 2.69 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|