C16H16F2N2O4S — CID 10317066
3-(2,4-difluorophenoxy)-4-(methanesulfonamido)-N,N-dimethylbenzamide (PubChem CID 10317066) has the molecular formula C16H16F2N2O4S and a molecular weight of 370.38 g/mol. Its IUPAC name is 3-(2,4-difluorophenoxy)-4-(methanesulfonamido)-N,N-dimethylbenzamide.
| Compound Name | 3-(2,4-difluorophenoxy)-4-(methanesulfonamido)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 10317066 |
| Molecular Formula | C16H16F2N2O4S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 3-(2,4-difluorophenoxy)-4-(methanesulfonamido)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NS(C)(=O)=O)c(Oc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C16H16F2N2O4S/c1-20(2)16(21)10-4-6-13(19-25(3,22)23)15(8-10)24-14-7-5-11(17)9-12(14)18/h4-9,19H,1-3H3 |
| InChIKey | FRIWYDYIVAGPKB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |