C16H16F2N2O3S2 — CID 10430237
3-(2,4-difluorophenyl)sulfanyl-N-ethyl-4-(methanesulfonamido)benzamide (PubChem CID 10430237) has the molecular formula C16H16F2N2O3S2 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)sulfanyl-N-ethyl-4-(methanesulfonamido)benzamide.
| Compound Name | 3-(2,4-difluorophenyl)sulfanyl-N-ethyl-4-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 10430237 |
| Molecular Formula | C16H16F2N2O3S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 3-(2,4-difluorophenyl)sulfanyl-N-ethyl-4-(methanesulfonamido)benzamide |
| SMILES | CCNC(=O)c1ccc(NS(C)(=O)=O)c(Sc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C16H16F2N2O3S2/c1-3-19-16(21)10-4-6-13(20-25(2,22)23)15(8-10)24-14-7-5-11(17)9-12(14)18/h4-9,20H,3H2,1-2H3,(H,19,21) |
| InChIKey | CZOGHJNKZMAJKI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |