C14H13F2NO4S3 — CID 57245263
2-(2,4-difluorophenyl)sulfanyl-4-(methylsulfonylmethyl)-1-(sulfinoamino)benzene (PubChem CID 57245263) has the molecular formula C14H13F2NO4S3 and a molecular weight of 393.46 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-4-(methylsulfonylmethyl)-1-(sulfinoamino)benzene.
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-4-(methylsulfonylmethyl)-1-(sulfinoamino)benzene |
|---|---|
| PubChem CID | 57245263 |
| Molecular Formula | C14H13F2NO4S3 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-4-(methylsulfonylmethyl)-1-(sulfinoamino)benzene |
| SMILES | CS(=O)(=O)Cc1ccc(NS(=O)O)c(Sc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C14H13F2NO4S3/c1-24(20,21)8-9-2-4-12(17-23(18)19)14(6-9)22-13-5-3-10(15)7-11(13)16/h2-7,17H,8H2,1H3,(H,18,19) |
| InChIKey | BJSKGMAHLSHYPR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|