C15H13F2NO5S2 — CID 57298834
4-acetyl-2-[(2,4-difluorophenyl)sulfonylmethyl]-1-(sulfinoamino)benzene (PubChem CID 57298834) has the molecular formula C15H13F2NO5S2 and a molecular weight of 389.40 g/mol. Its IUPAC name is 4-acetyl-2-[(2,4-difluorophenyl)sulfonylmethyl]-1-(sulfinoamino)benzene.
| Compound Name | 4-acetyl-2-[(2,4-difluorophenyl)sulfonylmethyl]-1-(sulfinoamino)benzene |
|---|---|
| PubChem CID | 57298834 |
| Molecular Formula | C15H13F2NO5S2 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 4-acetyl-2-[(2,4-difluorophenyl)sulfonylmethyl]-1-(sulfinoamino)benzene |
| SMILES | CC(=O)c1ccc(NS(=O)O)c(CS(=O)(=O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C15H13F2NO5S2/c1-9(19)10-2-4-14(18-24(20)21)11(6-10)8-25(22,23)15-5-3-12(16)7-13(15)17/h2-7,18H,8H2,1H3,(H,20,21) |
| InChIKey | FWXOVWHDGJRWSX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|