C16H16NO6S2- — CID 57067608
4-acetyl-2-[(2-methylsulfonylphenoxy)methyl]-1-(sulfinatoamino)benzene (PubChem CID 57067608) has the molecular formula C16H16NO6S2- and a molecular weight of 382.44 g/mol. Its IUPAC name is 4-acetyl-2-[(2-methylsulfonylphenoxy)methyl]-1-(sulfinatoamino)benzene.
| Compound Name | 4-acetyl-2-[(2-methylsulfonylphenoxy)methyl]-1-(sulfinatoamino)benzene |
|---|---|
| PubChem CID | 57067608 |
| Molecular Formula | C16H16NO6S2- |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 4-acetyl-2-[(2-methylsulfonylphenoxy)methyl]-1-(sulfinatoamino)benzene |
| SMILES | CC(=O)c1ccc(NS(=O)[O-])c(COc2ccccc2S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H17NO6S2/c1-11(18)12-7-8-14(17-24(19)20)13(9-12)10-23-15-5-3-4-6-16(15)25(2,21)22/h3-9,17H,10H2,1-2H3,(H,19,20)/p-1 |
| InChIKey | VPBBTJBHGQVPBR-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|