C15H13Cl2NO4S — CID 57250068
2-[[5-acetyl-2-(sulfinoamino)phenyl]methoxy]-1,3-dichlorobenzene (PubChem CID 57250068) has the molecular formula C15H13Cl2NO4S and a molecular weight of 374.25 g/mol. Its IUPAC name is 2-[[5-acetyl-2-(sulfinoamino)phenyl]methoxy]-1,3-dichlorobenzene.
| Compound Name | 2-[[5-acetyl-2-(sulfinoamino)phenyl]methoxy]-1,3-dichlorobenzene |
|---|---|
| PubChem CID | 57250068 |
| Molecular Formula | C15H13Cl2NO4S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 2-[[5-acetyl-2-(sulfinoamino)phenyl]methoxy]-1,3-dichlorobenzene |
| SMILES | CC(=O)c1ccc(NS(=O)O)c(COc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C15H13Cl2NO4S/c1-9(19)10-5-6-14(18-23(20)21)11(7-10)8-22-15-12(16)3-2-4-13(15)17/h2-7,18H,8H2,1H3,(H,20,21) |
| InChIKey | VHHBXWMFSOMYQR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|